About 2-nitroguanidine;2-nitrophenol
2-nitroguanidine;2-nitrophenol (PubChem CID 18323468) has the molecular formula C7H9N5O5
and a molecular weight of 243.18 g/mol. Its IUPAC name is 2-nitroguanidine;2-nitrophenol.
Molecular Properties
| Compound Name | 2-nitroguanidine;2-nitrophenol |
| PubChem CID | 18323468 |
| Molecular Formula | C7H9N5O5 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-nitroguanidine;2-nitrophenol |
| SMILES | NC(N)=N[N+](=O)[O-].O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C6H5NO3.CH4N4O2/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4-5(6)7/h1-4,8H;(H4,2,3,4) |
| InChIKey | LZNIUKVFRQZTBI-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 170.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroguanidine;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroguanidine;2-nitrophenol?
The IUPAC name of 2-nitroguanidine;2-nitrophenol (CID 18323468) is 2-nitroguanidine;2-nitrophenol.
What is the SMILES notation for 2-nitroguanidine;2-nitrophenol?
The canonical SMILES for 2-nitroguanidine;2-nitrophenol is NC(N)=N[N+](=O)[O-].O=[N+]([O-])c1ccccc1O.
What is the InChIKey of 2-nitroguanidine;2-nitrophenol?
The InChIKey is LZNIUKVFRQZTBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.CH4N4O2/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4-5(6)7/h1-4,8H;(H4,2,3,4).
What are the key properties of 2-nitroguanidine;2-nitrophenol?
2-nitroguanidine;2-nitrophenol has a molecular weight of 243.18 g/mol, XLogP of -0.25, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroguanidine;2-nitrophenol is sourced from PubChem (CID 18323468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).