C12H10NNa3O10 — CID 175309279
trisodium;2-hydroxypropane-1,2,3-tricarboxylate;2-nitrophenol (PubChem CID 175309279) has the molecular formula C12H10NNa3O10 and a molecular weight of 397.18 g/mol. Its IUPAC name is trisodium;2-hydroxypropane-1,2,3-tricarboxylate;2-nitrophenol.
| Compound Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;2-nitrophenol |
|---|---|
| PubChem CID | 175309279 |
| Molecular Formula | C12H10NNa3O10 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;2-nitrophenol |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=[N+]([O-])c1ccccc1O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H5NO3.C6H8O7.3Na/c8-6-4-2-1-3-5(6)7(9)10;7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h1-4,8H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;;3*+1/p-3 |
| InChIKey | OEZMPJLXZCYRPP-UHFFFAOYSA-K |
| XLogP | -12.94 |
| TPSA | 203.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | -12.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|