About 7-nitro-1H-indole;2-nitrophenol
7-nitro-1H-indole;2-nitrophenol (PubChem CID 159038784) has the molecular formula C14H11N3O5
and a molecular weight of 301.26 g/mol. Its IUPAC name is 7-nitro-1H-indole;2-nitrophenol.
Molecular Properties
| Compound Name | 7-nitro-1H-indole;2-nitrophenol |
| PubChem CID | 159038784 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 7-nitro-1H-indole;2-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc2cc[nH]c12.O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C8H6N2O2.C6H5NO3/c11-10(12)7-3-1-2-6-4-5-9-8(6)7;8-6-4-2-1-3-5(6)7(9)10/h1-5,9H;1-4,8H |
| InChIKey | JVTZTXAUDMKNNY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-1H-indole;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-1H-indole;2-nitrophenol?
The IUPAC name of 7-nitro-1H-indole;2-nitrophenol (CID 159038784) is 7-nitro-1H-indole;2-nitrophenol.
What is the SMILES notation for 7-nitro-1H-indole;2-nitrophenol?
The canonical SMILES for 7-nitro-1H-indole;2-nitrophenol is O=[N+]([O-])c1cccc2cc[nH]c12.O=[N+]([O-])c1ccccc1O.
What is the InChIKey of 7-nitro-1H-indole;2-nitrophenol?
The InChIKey is JVTZTXAUDMKNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C6H5NO3/c11-10(12)7-3-1-2-6-4-5-9-8(6)7;8-6-4-2-1-3-5(6)7(9)10/h1-5,9H;1-4,8H.
What are the key properties of 7-nitro-1H-indole;2-nitrophenol?
7-nitro-1H-indole;2-nitrophenol has a molecular weight of 301.26 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-1H-indole;2-nitrophenol is sourced from PubChem (CID 159038784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).