C13H13NO3 — CID 10513686
(1S,2S,4R)-2-(2-nitrophenyl)bicyclo[2.2.1]heptan-7-one (PubChem CID 10513686) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (1S,2S,4R)-2-(2-nitrophenyl)bicyclo[2.2.1]heptan-7-one.
| Compound Name | (1S,2S,4R)-2-(2-nitrophenyl)bicyclo[2.2.1]heptan-7-one |
|---|---|
| PubChem CID | 10513686 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (1S,2S,4R)-2-(2-nitrophenyl)bicyclo[2.2.1]heptan-7-one |
| SMILES | O=C1[C@@H]2CC[C@H]1[C@@H](c1ccccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C13H13NO3/c15-13-8-5-6-10(13)11(7-8)9-3-1-2-4-12(9)14(16)17/h1-4,8,10-11H,5-7H2/t8-,10+,11-/m1/s1 |
| InChIKey | HZMRYRZPWKGBMB-DVVUODLYSA-N |
| XLogP | 2.68 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|