C9H9ClN2O4 — CID 171183708
(4S)-4-(2-nitrophenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171183708) has the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. Its IUPAC name is (4S)-4-(2-nitrophenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4S)-4-(2-nitrophenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171183708 |
| Molecular Formula | C9H9ClN2O4 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (4S)-4-(2-nitrophenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccccc2[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C9H8N2O4.ClH/c12-9-10-7(5-15-9)6-3-1-2-4-8(6)11(13)14;/h1-4,7H,5H2,(H,10,12);1H/t7-;/m1./s1 |
| InChIKey | UEVQRQYZFLZBCC-OGFXRTJISA-N |
| XLogP | 1.80 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|