C15H14Cl2N6O4 — CID 71618706
[1-[1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl]triazol-4-yl]methanol (PubChem CID 71618706) has the molecular formula C15H14Cl2N6O4 and a molecular weight of 413.22 g/mol. Its IUPAC name is [1-[1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl]triazol-4-yl]methanol.
| Compound Name | [1-[1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 71618706 |
| Molecular Formula | C15H14Cl2N6O4 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [1-[1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl]triazol-4-yl]methanol |
| SMILES | COc1nc([N+](=O)[O-])cn1CC(c1ccc(Cl)cc1Cl)n1cc(CO)nn1 |
| InChI | InChI=1S/C15H14Cl2N6O4/c1-27-15-18-14(23(25)26)7-21(15)6-13(22-5-10(8-24)19-20-22)11-3-2-9(16)4-12(11)17/h2-5,7,13,24H,6,8H2,1H3 |
| InChIKey | RXVHOFJVEKETQD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|