C15H19Cl2N3O4 — CID 70555093
2-(2-tert-butylimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanol;nitric acid (PubChem CID 70555093) has the molecular formula C15H19Cl2N3O4 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(2-tert-butylimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanol;nitric acid.
| Compound Name | 2-(2-tert-butylimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanol;nitric acid |
|---|---|
| PubChem CID | 70555093 |
| Molecular Formula | C15H19Cl2N3O4 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-(2-tert-butylimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanol;nitric acid |
| SMILES | CC(C)(C)c1nccn1CC(O)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C15H18Cl2N2O.HNO3/c1-15(2,3)14-18-6-7-19(14)9-13(20)11-5-4-10(16)8-12(11)17;2-1(3)4/h4-8,13,20H,9H2,1-3H3;(H,2,3,4) |
| InChIKey | GWUPCWYXDYDJPN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|