C36H31Cl6N5O3S2 — CID 135290396
bis(1-[2-[(4-chlorophenyl)methylsulfanyl]-2-(2,4-dichlorophenyl)ethyl]imidazole);nitric acid (PubChem CID 135290396) has the molecular formula C36H31Cl6N5O3S2 and a molecular weight of 858.53 g/mol. Its IUPAC name is bis(1-[2-[(4-chlorophenyl)methylsulfanyl]-2-(2,4-dichlorophenyl)ethyl]imidazole);nitric acid.
| Compound Name | bis(1-[2-[(4-chlorophenyl)methylsulfanyl]-2-(2,4-dichlorophenyl)ethyl]imidazole);nitric acid |
|---|---|
| PubChem CID | 135290396 |
| Molecular Formula | C36H31Cl6N5O3S2 |
| Molecular Weight | 858.53 g/mol |
| Exact Mass | 855.00 |
| IUPAC Name | bis(1-[2-[(4-chlorophenyl)methylsulfanyl]-2-(2,4-dichlorophenyl)ethyl]imidazole);nitric acid |
| SMILES | Clc1ccc(CSC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1.Clc1ccc(CSC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/2C18H15Cl3N2S.HNO3/c2*19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h2*1-9,12,18H,10-11H2;(H,2,3,4) |
| InChIKey | HVFKMPLKRXQGPC-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.53 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|