C24H21Cl2N3O4 — CID 70595520
1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenyl)methoxy]ethyl]imidazole;nitric acid (PubChem CID 70595520) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenyl)methoxy]ethyl]imidazole;nitric acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenyl)methoxy]ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70595520 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenyl)methoxy]ethyl]imidazole;nitric acid |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCc2ccc(-c3ccccc3)cc2)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C24H20Cl2N2O.HNO3/c25-21-10-11-22(23(26)14-21)24(15-28-13-12-27-17-28)29-16-18-6-8-20(9-7-18)19-4-2-1-3-5-19;2-1(3)4/h1-14,17,24H,15-16H2;(H,2,3,4) |
| InChIKey | CJWIPBSZUBAVBF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|