C20H15Cl4N3O5 — CID 70500005
1-[2-[(5,7-dichloro-1-benzofuran-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid (PubChem CID 70500005) has the molecular formula C20H15Cl4N3O5 and a molecular weight of 519.17 g/mol. Its IUPAC name is 1-[2-[(5,7-dichloro-1-benzofuran-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid.
| Compound Name | 1-[2-[(5,7-dichloro-1-benzofuran-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70500005 |
| Molecular Formula | C20H15Cl4N3O5 |
| Molecular Weight | 519.17 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | 1-[2-[(5,7-dichloro-1-benzofuran-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCc2coc3c(Cl)cc(Cl)cc23)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C20H14Cl4N2O2.HNO3/c21-13-1-2-15(17(23)6-13)19(8-26-4-3-25-11-26)27-9-12-10-28-20-16(12)5-14(22)7-18(20)24;2-1(3)4/h1-7,10-11,19H,8-9H2;(H,2,3,4) |
| InChIKey | BNOCVWZJPOCEID-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.17 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|