C19H19Cl2N3O5 — CID 162318190
1-[2-(2,4-dichlorophenyl)-2-[(4-methoxyphenyl)methoxy]ethyl]imidazole;nitric acid (PubChem CID 162318190) has the molecular formula C19H19Cl2N3O5 and a molecular weight of 440.28 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[(4-methoxyphenyl)methoxy]ethyl]imidazole;nitric acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-methoxyphenyl)methoxy]ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 162318190 |
| Molecular Formula | C19H19Cl2N3O5 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-methoxyphenyl)methoxy]ethyl]imidazole;nitric acid |
| SMILES | COc1ccc(COC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H18Cl2N2O2.HNO3/c1-24-16-5-2-14(3-6-16)12-25-19(11-23-9-8-22-13-23)17-7-4-15(20)10-18(17)21;2-1(3)4/h2-10,13,19H,11-12H2,1H3;(H,2,3,4) |
| InChIKey | UJBJJDWLXMQNFS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|