C35H42Cl4N4O7 — CID 11643484
4-[3-(4-butoxyphenoxy)propyl]morpholine;1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid (PubChem CID 11643484) has the molecular formula C35H42Cl4N4O7 and a molecular weight of 772.55 g/mol. Its IUPAC name is 4-[3-(4-butoxyphenoxy)propyl]morpholine;1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid.
| Compound Name | 4-[3-(4-butoxyphenoxy)propyl]morpholine;1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 11643484 |
| Molecular Formula | C35H42Cl4N4O7 |
| Molecular Weight | 772.55 g/mol |
| Exact Mass | 770.18 |
| IUPAC Name | 4-[3-(4-butoxyphenoxy)propyl]morpholine;1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid |
| SMILES | CCCCOc1ccc(OCCCN2CCOCC2)cc1.Clc1ccc(COC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C18H14Cl4N2O.C17H27NO3.HNO3/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22;1-2-3-12-20-16-5-7-17(8-6-16)21-13-4-9-18-10-14-19-15-11-18;2-1(3)4/h1-8,11,18H,9-10H2;5-8H,2-4,9-15H2,1H3;(H,2,3,4) |
| InChIKey | VUVNFYONAGPMDN-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.55 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|