C17H21Cl2N3O5 — CID 161064059
1-[1-[2-butoxy-2-(2,4-dichlorophenyl)ethoxy]ethenyl]imidazole;nitric acid (PubChem CID 161064059) has the molecular formula C17H21Cl2N3O5 and a molecular weight of 418.28 g/mol. Its IUPAC name is 1-[1-[2-butoxy-2-(2,4-dichlorophenyl)ethoxy]ethenyl]imidazole;nitric acid.
| Compound Name | 1-[1-[2-butoxy-2-(2,4-dichlorophenyl)ethoxy]ethenyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 161064059 |
| Molecular Formula | C17H21Cl2N3O5 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 1-[1-[2-butoxy-2-(2,4-dichlorophenyl)ethoxy]ethenyl]imidazole;nitric acid |
| SMILES | C=C(OCC(OCCCC)c1ccc(Cl)cc1Cl)n1ccnc1.O=[N+]([O-])O |
| InChI | InChI=1S/C17H20Cl2N2O2.HNO3/c1-3-4-9-22-17(15-6-5-14(18)10-16(15)19)11-23-13(2)21-8-7-20-12-21;2-1(3)4/h5-8,10,12,17H,2-4,9,11H2,1H3;(H,2,3,4) |
| InChIKey | YLZNAKKRNXQCEN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|