C16H22Cl2N4O4 — CID 70453675
1-[2-(2,4-dichlorophenyl)-2-hexoxyethyl]-1,2,4-triazole;nitric acid (PubChem CID 70453675) has the molecular formula C16H22Cl2N4O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-hexoxyethyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-hexoxyethyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70453675 |
| Molecular Formula | C16H22Cl2N4O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-hexoxyethyl]-1,2,4-triazole;nitric acid |
| SMILES | CCCCCCOC(Cn1cncn1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C16H21Cl2N3O.HNO3/c1-2-3-4-5-8-22-16(10-21-12-19-11-20-21)14-7-6-13(17)9-15(14)18;2-1(3)4/h6-7,9,11-12,16H,2-5,8,10H2,1H3;(H,2,3,4) |
| InChIKey | ODISKEODEYTKCJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|