C16H21Cl2N3O2 — CID 89130546
1-[2-(2,4-dichlorophenyl)-2-methoxy-2-pentoxyethyl]-1,2,4-triazole (PubChem CID 89130546) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-methoxy-2-pentoxyethyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-methoxy-2-pentoxyethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 89130546 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-methoxy-2-pentoxyethyl]-1,2,4-triazole |
| SMILES | CCCCCOC(Cn1cncn1)(OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-3-4-5-8-23-16(22-2,10-21-12-19-11-20-21)14-7-6-13(17)9-15(14)18/h6-7,9,11-12H,3-5,8,10H2,1-2H3 |
| InChIKey | GEKBUTHWLLQBBV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|