C22H25Cl2N3O2 — CID 70465829
1-[3-butoxy-2-(2,4-dichlorophenyl)-2-phenylmethoxypropyl]-1,2,4-triazole (PubChem CID 70465829) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 1-[3-butoxy-2-(2,4-dichlorophenyl)-2-phenylmethoxypropyl]-1,2,4-triazole.
| Compound Name | 1-[3-butoxy-2-(2,4-dichlorophenyl)-2-phenylmethoxypropyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70465829 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-[3-butoxy-2-(2,4-dichlorophenyl)-2-phenylmethoxypropyl]-1,2,4-triazole |
| SMILES | CCCCOCC(Cn1cncn1)(OCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-2-3-11-28-15-22(14-27-17-25-16-26-27,20-10-9-19(23)12-21(20)24)29-13-18-7-5-4-6-8-18/h4-10,12,16-17H,2-3,11,13-15H2,1H3 |
| InChIKey | NSBQUGFOOOMZMU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|