C17H17Cl2N3O — CID 71323960
1-[2-(2,4-dichlorophenyl)-2-ethoxyhept-6-en-3-ynyl]-1,2,4-triazole (PubChem CID 71323960) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-ethoxyhept-6-en-3-ynyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-ethoxyhept-6-en-3-ynyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 71323960 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-ethoxyhept-6-en-3-ynyl]-1,2,4-triazole |
| SMILES | C=CCC#CC(Cn1cncn1)(OCC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O/c1-3-5-6-9-17(23-4-2,11-22-13-20-12-21-22)15-8-7-14(18)10-16(15)19/h3,7-8,10,12-13H,1,4-5,11H2,2H3 |
| InChIKey | HHFUMUPUOZBEIH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|