C17H19Cl2N3O — CID 101407238
2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)non-3-yn-2-ol (PubChem CID 101407238) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)non-3-yn-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)non-3-yn-2-ol |
|---|---|
| PubChem CID | 101407238 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)non-3-yn-2-ol |
| SMILES | CCCCCC#CC(O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2N3O/c1-2-3-4-5-6-9-17(23,11-22-13-20-12-21-22)15-8-7-14(18)10-16(15)19/h7-8,10,12-13,23H,2-5,11H2,1H3 |
| InChIKey | JEVUIMRVJQURJZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|