C13H19Cl2NO3 — CID 144898026
2-(2,4-dichlorophenyl)-2-methoxy-2-(3-methoxypropoxy)ethanamine (PubChem CID 144898026) has the molecular formula C13H19Cl2NO3 and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-methoxy-2-(3-methoxypropoxy)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-2-methoxy-2-(3-methoxypropoxy)ethanamine |
|---|---|
| PubChem CID | 144898026 |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-methoxy-2-(3-methoxypropoxy)ethanamine |
| SMILES | COCCCOC(CN)(OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO3/c1-17-6-3-7-19-13(9-16,18-2)11-5-4-10(14)8-12(11)15/h4-5,8H,3,6-7,9,16H2,1-2H3 |
| InChIKey | QNGXQEUEAXODNG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|