C17H15Cl3N4O3 — CID 70453607
1-[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)propyl]-1,2,4-triazole;nitric acid (PubChem CID 70453607) has the molecular formula C17H15Cl3N4O3 and a molecular weight of 429.69 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)propyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)propyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70453607 |
| Molecular Formula | C17H15Cl3N4O3 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)propyl]-1,2,4-triazole;nitric acid |
| SMILES | Clc1ccc(CC(Cn2cncn2)c2ccc(Cl)cc2Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C17H14Cl3N3.HNO3/c18-14-3-1-12(2-4-14)7-13(9-23-11-21-10-22-23)16-6-5-15(19)8-17(16)20;2-1(3)4/h1-6,8,10-11,13H,7,9H2;(H,2,3,4) |
| InChIKey | YRVHNUBSOQAVDU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|