C12H14Cl2N4O4 — CID 70453630
1-[2-(2,4-dichlorophenyl)-2-ethoxyethyl]-1,2,4-triazole;nitric acid (PubChem CID 70453630) has the molecular formula C12H14Cl2N4O4 and a molecular weight of 349.17 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-ethoxyethyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-ethoxyethyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70453630 |
| Molecular Formula | C12H14Cl2N4O4 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-ethoxyethyl]-1,2,4-triazole;nitric acid |
| SMILES | CCOC(Cn1cncn1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C12H13Cl2N3O.HNO3/c1-2-18-12(6-17-8-15-7-16-17)10-4-3-9(13)5-11(10)14;2-1(3)4/h3-5,7-8,12H,2,6H2,1H3;(H,2,3,4) |
| InChIKey | XEBLBMYKYFLWHY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|