C14H17Cl2N3O2 — CID 89492984
2-[1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethoxy]butan-1-ol (PubChem CID 89492984) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethoxy]butan-1-ol.
| Compound Name | 2-[1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethoxy]butan-1-ol |
|---|---|
| PubChem CID | 89492984 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethoxy]butan-1-ol |
| SMILES | CCC(CO)OC(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-2-11(7-20)21-14(6-19-9-17-8-18-19)12-4-3-10(15)5-13(12)16/h3-5,8-9,11,14,20H,2,6-7H2,1H3 |
| InChIKey | RZBZEELZVYYEHK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |