C11H11Cl2N3O — CID 70382628
1-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 70382628) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 70382628 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)Cn1cncn1 |
| InChI | InChI=1S/C11H11Cl2N3O/c12-9-2-1-8(11(13)4-9)3-10(17)5-16-7-14-6-15-16/h1-2,4,6-7,10,17H,3,5H2 |
| InChIKey | XAJZULCOJJHOSF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |