C12H11Cl2NOS — CID 112642484
1-(2,4-dichlorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol (PubChem CID 112642484) has the molecular formula C12H11Cl2NOS and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 112642484 |
| Molecular Formula | C12H11Cl2NOS |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol |
| SMILES | OC(Cc1cncs1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NOS/c13-9-2-1-8(12(14)4-9)3-10(16)5-11-6-15-7-17-11/h1-2,4,6-7,10,16H,3,5H2 |
| InChIKey | YEOJEEAAGOLKLF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |