C12H11ClFNOS — CID 112642524
1-(2-chloro-6-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol (PubChem CID 112642524) has the molecular formula C12H11ClFNOS and a molecular weight of 271.74 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 112642524 |
| Molecular Formula | C12H11ClFNOS |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-2-ol |
| SMILES | OC(Cc1cncs1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H11ClFNOS/c13-11-2-1-3-12(14)10(11)5-8(16)4-9-6-15-7-17-9/h1-3,6-8,16H,4-5H2 |
| InChIKey | IMMGRZLYKRDKCQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |