C12H12ClNO2S — CID 105123232
1-(4-chlorophenoxy)-3-(1,3-thiazol-5-yl)propan-2-ol (PubChem CID 105123232) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-(1,3-thiazol-5-yl)propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-(1,3-thiazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 105123232 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-(1,3-thiazol-5-yl)propan-2-ol |
| SMILES | OC(COc1ccc(Cl)cc1)Cc1cncs1 |
| InChI | InChI=1S/C12H12ClNO2S/c13-9-1-3-11(4-2-9)16-7-10(15)5-12-6-14-8-17-12/h1-4,6,8,10,15H,5,7H2 |
| InChIKey | QQHWKJQYKALFHN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |