C11H13N3O — CID 19849797
1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 19849797) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 19849797 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(Cc1ccccc1)Cn1cncn1 |
| InChI | InChI=1S/C11H13N3O/c15-11(7-14-9-12-8-13-14)6-10-4-2-1-3-5-10/h1-5,8-9,11,15H,6-7H2 |
| InChIKey | AEMFKWCHSLHKGS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |