About (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol
(2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol (PubChem CID 95147348) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol |
| PubChem CID | 95147348 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol |
| SMILES | O[C@H](Cc1ccccc1)Cn1cnnc1 |
| InChI | InChI=1S/C11H13N3O/c15-11(7-14-8-12-13-9-14)6-10-4-2-1-3-5-10/h1-5,8-9,11,15H,6-7H2/t11-/m1/s1 |
| InChIKey | LXMLLDSOLONUEW-LLVKDONJSA-N |
| XLogP | 0.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol?
The IUPAC name of (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol (CID 95147348) is (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol.
What is the SMILES notation for (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol?
The canonical SMILES for (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol is O[C@H](Cc1ccccc1)Cn1cnnc1.
What is the InChIKey of (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol?
The InChIKey is LXMLLDSOLONUEW-LLVKDONJSA-N. The full InChI is InChI=1S/C11H13N3O/c15-11(7-14-8-12-13-9-14)6-10-4-2-1-3-5-10/h1-5,8-9,11,15H,6-7H2/t11-/m1/s1.
What are the key properties of (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol?
(2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol has a molecular weight of 203.25 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-phenyl-3-(1,2,4-triazol-4-yl)propan-2-ol is sourced from PubChem (CID 95147348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).