C14H14Cl2N4O — CID 10568043
3-[2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propoxy]propanenitrile (PubChem CID 10568043) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propoxy]propanenitrile.
| Compound Name | 3-[2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propoxy]propanenitrile |
|---|---|
| PubChem CID | 10568043 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propoxy]propanenitrile |
| SMILES | N#CCCOCC(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O/c15-12-2-3-13(14(16)6-12)11(8-21-5-1-4-17)7-20-10-18-9-19-20/h2-3,6,9-11H,1,5,7-8H2 |
| InChIKey | KPPBDKJNTNUFHY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|