C28H24Cl4F8N6O — CID 23213337
1-[3-(2,4-dichlorophenyl)-6-[4-(2,4-dichlorophenyl)-1,1,2,2-tetrafluoro-6-(1,2,4-triazol-1-yl)hexoxy]-5,5,6,6-tetrafluorohexyl]-1,2,4-triazole (PubChem CID 23213337) has the molecular formula C28H24Cl4F8N6O and a molecular weight of 754.34 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)-6-[4-(2,4-dichlorophenyl)-1,1,2,2-tetrafluoro-6-(1,2,4-triazol-1-yl)hexoxy]-5,5,6,6-tetrafluorohexyl]-1,2,4-triazole.
| Compound Name | 1-[3-(2,4-dichlorophenyl)-6-[4-(2,4-dichlorophenyl)-1,1,2,2-tetrafluoro-6-(1,2,4-triazol-1-yl)hexoxy]-5,5,6,6-tetrafluorohexyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23213337 |
| Molecular Formula | C28H24Cl4F8N6O |
| Molecular Weight | 754.34 g/mol |
| Exact Mass | 752.06 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)-6-[4-(2,4-dichlorophenyl)-1,1,2,2-tetrafluoro-6-(1,2,4-triazol-1-yl)hexoxy]-5,5,6,6-tetrafluorohexyl]-1,2,4-triazole |
| SMILES | FC(F)(CC(CCn1cncn1)c1ccc(Cl)cc1Cl)C(F)(F)OC(F)(F)C(F)(F)CC(CCn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H24Cl4F8N6O/c29-19-1-3-21(23(31)9-19)17(5-7-45-15-41-13-43-45)11-25(33,34)27(37,38)47-28(39,40)26(35,36)12-18(6-8-46-16-42-14-44-46)22-4-2-20(30)10-24(22)32/h1-4,9-10,13-18H,5-8,11-12H2 |
| InChIKey | BXLVXPYWBMBPJH-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.34 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|