C20H19Cl2N3O — CID 10572328
1-[2-(2,4-dichlorophenyl)-3-[(E)-3-phenylprop-2-enoxy]propyl]-1,2,4-triazole (PubChem CID 10572328) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-3-[(E)-3-phenylprop-2-enoxy]propyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-3-[(E)-3-phenylprop-2-enoxy]propyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10572328 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-3-[(E)-3-phenylprop-2-enoxy]propyl]-1,2,4-triazole |
| SMILES | Clc1ccc(C(COC/C=C/c2ccccc2)Cn2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O/c21-18-8-9-19(20(22)11-18)17(12-25-15-23-14-24-25)13-26-10-4-7-16-5-2-1-3-6-16/h1-9,11,14-15,17H,10,12-13H2/b7-4+ |
| InChIKey | SOPXJUQZJPVOCG-QPJJXVBHSA-N |
| XLogP | 5.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|