C22H21Cl2N3O3 — CID 70552947
1-[[2-(2,4-dichlorophenyl)-4-(3-phenylprop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 70552947) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-(3-phenylprop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-(3-phenylprop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70552947 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-(3-phenylprop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCC(COCC=Cc3ccccc3)O2)c(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c23-18-8-9-20(21(24)11-18)22(14-27-16-25-15-26-27)29-13-19(30-22)12-28-10-4-7-17-5-2-1-3-6-17/h1-9,11,15-16,19H,10,12-14H2 |
| InChIKey | VMOVVWCXNNAJAZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|