C23H25Cl2N5O3 — CID 12854837
1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine (PubChem CID 12854837) has the molecular formula C23H25Cl2N5O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
|---|---|
| PubChem CID | 12854837 |
| Molecular Formula | C23H25Cl2N5O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCC(COc3ccc(N4CCNCC4)cc3)O2)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl2N5O3/c24-17-1-6-21(22(25)11-17)23(14-30-16-27-15-28-30)32-13-20(33-23)12-31-19-4-2-18(3-5-19)29-9-7-26-8-10-29/h1-6,11,15-16,20,26H,7-10,12-14H2 |
| InChIKey | SOLQXQASKIOXJI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|