C34H36Cl2N8O3 — CID 12876989
1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-propyl-1,2,4-triazol-1-yl)phenyl]piperazine (PubChem CID 12876989) has the molecular formula C34H36Cl2N8O3 and a molecular weight of 675.62 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-propyl-1,2,4-triazol-1-yl)phenyl]piperazine.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-propyl-1,2,4-triazol-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 12876989 |
| Molecular Formula | C34H36Cl2N8O3 |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-propyl-1,2,4-triazol-1-yl)phenyl]piperazine |
| SMILES | CCCc1ncnn1-c1ccc(N2CCN(c3ccc(OCC4COC(Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H36Cl2N8O3/c1-2-3-33-38-23-40-44(33)28-7-5-26(6-8-28)41-14-16-42(17-15-41)27-9-11-29(12-10-27)45-19-30-20-46-34(47-30,21-43-24-37-22-39-43)31-13-4-25(35)18-32(31)36/h4-13,18,22-24,30H,2-3,14-17,19-21H2,1H3 |
| InChIKey | DJGMAEASFFTTPR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 95.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|