C32H35Cl2N5O4 — CID 54163876
1-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine (PubChem CID 54163876) has the molecular formula C32H35Cl2N5O4 and a molecular weight of 624.57 g/mol. Its IUPAC name is 1-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 54163876 |
| Molecular Formula | C32H35Cl2N5O4 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 1-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine |
| SMILES | COc1ccc(CCN2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H35Cl2N5O4/c1-40-27-7-2-24(3-8-27)12-13-37-14-16-38(17-15-37)26-5-9-28(10-6-26)41-19-29-20-42-32(43-29,21-39-23-35-22-36-39)30-11-4-25(33)18-31(30)34/h2-11,18,22-23,29H,12-17,19-21H2,1H3/t29-,32-/m1/s1 |
| InChIKey | OQHOSJXDLBCBMT-QLWXXVCSSA-N |
| XLogP | 5.31 |
| TPSA | 74.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|