C33H36Cl2N8O3 — CID 54152649
N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 54152649) has the molecular formula C33H36Cl2N8O3 and a molecular weight of 663.61 g/mol. Its IUPAC name is N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine.
| Compound Name | N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 54152649 |
| Molecular Formula | C33H36Cl2N8O3 |
| Molecular Weight | 663.61 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | CN1CCN=C1Nc1ccc(N2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H36Cl2N8O3/c1-40-13-12-37-32(40)39-25-3-5-26(6-4-25)41-14-16-42(17-15-41)27-7-9-28(10-8-27)44-19-29-20-45-33(46-29,21-43-23-36-22-38-43)30-11-2-24(34)18-31(30)35/h2-11,18,22-23,29H,12-17,19-21H2,1H3,(H,37,39)/t29-,33-/m1/s1 |
| InChIKey | OIUUGQGJOYHNGQ-CYTLCNBWSA-N |
| XLogP | 4.97 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|