C32H31Cl2N7O3 — CID 12876934
1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(4-pyrazol-1-ylphenyl)piperazine (PubChem CID 12876934) has the molecular formula C32H31Cl2N7O3 and a molecular weight of 632.55 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(4-pyrazol-1-ylphenyl)piperazine.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(4-pyrazol-1-ylphenyl)piperazine |
|---|---|
| PubChem CID | 12876934 |
| Molecular Formula | C32H31Cl2N7O3 |
| Molecular Weight | 632.55 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(4-pyrazol-1-ylphenyl)piperazine |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCC(COc3ccc(N4CCN(c5ccc(-n6cccn6)cc5)CC4)cc3)O2)c(Cl)c1 |
| InChI | InChI=1S/C32H31Cl2N7O3/c33-24-2-11-30(31(34)18-24)32(21-40-23-35-22-37-40)43-20-29(44-32)19-42-28-9-7-26(8-10-28)39-16-14-38(15-17-39)25-3-5-27(6-4-25)41-13-1-12-36-41/h1-13,18,22-23,29H,14-17,19-21H2 |
| InChIKey | HTUHYJRZRAMDBL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|