C33H34Cl2N8O3S — CID 12876949
1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-methyl-3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine (PubChem CID 12876949) has the molecular formula C33H34Cl2N8O3S and a molecular weight of 693.66 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-methyl-3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-methyl-3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 12876949 |
| Molecular Formula | C33H34Cl2N8O3S |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[4-(5-methyl-3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine |
| SMILES | CSc1nc(C)n(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)n1 |
| InChI | InChI=1S/C33H34Cl2N8O3S/c1-23-38-32(47-2)39-43(23)27-6-4-25(5-7-27)40-13-15-41(16-14-40)26-8-10-28(11-9-26)44-18-29-19-45-33(46-29,20-42-22-36-21-37-42)30-12-3-24(34)17-31(30)35/h3-12,17,21-22,29H,13-16,18-20H2,1-2H3 |
| InChIKey | UUGIYZPOARUODG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|