C36H42Cl2N8O3 — CID 139617815
N-[3-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,3-diethylimidazolidin-2-imine (PubChem CID 139617815) has the molecular formula C36H42Cl2N8O3 and a molecular weight of 705.69 g/mol. Its IUPAC name is N-[3-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,3-diethylimidazolidin-2-imine.
| Compound Name | N-[3-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,3-diethylimidazolidin-2-imine |
|---|---|
| PubChem CID | 139617815 |
| Molecular Formula | C36H42Cl2N8O3 |
| Molecular Weight | 705.69 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | N-[3-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,3-diethylimidazolidin-2-imine |
| SMILES | CCN1CCN(CC)C1=Nc1cccc(N2CCN(c3ccc(OCC4COC(Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)c1 |
| InChI | InChI=1S/C36H42Cl2N8O3/c1-3-42-14-15-43(4-2)35(42)41-28-6-5-7-30(21-28)45-18-16-44(17-19-45)29-9-11-31(12-10-29)47-22-32-23-48-36(49-32,24-46-26-39-25-40-46)33-13-8-27(37)20-34(33)38/h5-13,20-21,25-26,32H,3-4,14-19,22-24H2,1-2H3 |
| InChIKey | YBTYSMYPZHANEY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|