C35H39Cl2N7O3S — CID 70392074
N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethyl-1,3-thiazinan-2-imine (PubChem CID 70392074) has the molecular formula C35H39Cl2N7O3S and a molecular weight of 708.72 g/mol. Its IUPAC name is N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 70392074 |
| Molecular Formula | C35H39Cl2N7O3S |
| Molecular Weight | 708.72 g/mol |
| Exact Mass | 707.22 |
| IUPAC Name | N-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethyl-1,3-thiazinan-2-imine |
| SMILES | CCN1CCCS/C1=N\c1ccc(N2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H39Cl2N7O3S/c1-2-41-14-3-19-48-34(41)40-27-5-7-28(8-6-27)42-15-17-43(18-16-42)29-9-11-30(12-10-29)45-21-31-22-46-35(47-31,23-44-25-38-24-39-44)32-13-4-26(36)20-33(32)37/h4-13,20,24-25,31H,2-3,14-19,21-23H2,1H3/b40-34-/t31-,35-/m1/s1 |
| InChIKey | OFRGMKLYAXUZHY-GUMXRIQFSA-N |
| XLogP | 6.71 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|