C16H17Cl2N3O3 — CID 15917776
1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 15917776) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 15917776 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | C=CCOCC1COC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C16H17Cl2N3O3/c1-2-5-22-7-13-8-23-16(24-13,9-21-11-19-10-20-21)14-4-3-12(17)6-15(14)18/h2-4,6,10-11,13H,1,5,7-9H2 |
| InChIKey | XTFHMQDCZWQJEI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|