C16H19Cl2N3O4 — CID 15917779
1-[[2-(2,4-dichlorophenyl)-4-(2-methoxyethoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 15917779) has the molecular formula C16H19Cl2N3O4 and a molecular weight of 388.25 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-(2-methoxyethoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-(2-methoxyethoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 15917779 |
| Molecular Formula | C16H19Cl2N3O4 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-(2-methoxyethoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | COCCOCC1COC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C16H19Cl2N3O4/c1-22-4-5-23-7-13-8-24-16(25-13,9-21-11-19-10-20-21)14-3-2-12(17)6-15(14)18/h2-3,6,10-11,13H,4-5,7-9H2,1H3 |
| InChIKey | GJPJYSWGQPAEAR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|