C20H16Cl2N4O3S — CID 23460958
1-[[2-(2,4-dichlorophenyl)-4-[(4-isothiocyanatophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 23460958) has the molecular formula C20H16Cl2N4O3S and a molecular weight of 463.35 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-[(4-isothiocyanatophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-[(4-isothiocyanatophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23460958 |
| Molecular Formula | C20H16Cl2N4O3S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-[(4-isothiocyanatophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | S=C=Nc1ccc(OCC2COC(Cn3cncn3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C20H16Cl2N4O3S/c21-14-1-6-18(19(22)7-14)20(10-26-12-23-11-25-26)28-9-17(29-20)8-27-16-4-2-15(3-5-16)24-13-30/h1-7,11-12,17H,8-10H2 |
| InChIKey | BIVLYQTTYRECPP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|