C24H23Cl2N5O3 — CID 57019811
1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-[[4-(3-ethylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 57019811) has the molecular formula C24H23Cl2N5O3 and a molecular weight of 500.39 g/mol. Its IUPAC name is 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-[[4-(3-ethylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-[[4-(3-ethylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 57019811 |
| Molecular Formula | C24H23Cl2N5O3 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-[[4-(3-ethylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | CCn1cncc1-c1ccc(OC[C@@H]2CO[C@@](Cn3cncn3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C24H23Cl2N5O3/c1-2-30-15-27-10-23(30)17-3-6-19(7-4-17)32-11-20-12-33-24(34-20,13-31-16-28-14-29-31)21-8-5-18(25)9-22(21)26/h3-10,14-16,20H,2,11-13H2,1H3/t20-,24-/m1/s1 |
| InChIKey | QOCWDQGVKGCXMY-HYBUGGRVSA-N |
| XLogP | 4.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |