C20H20Cl2N6O4 — CID 70575388
1-amino-1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea (PubChem CID 70575388) has the molecular formula C20H20Cl2N6O4 and a molecular weight of 479.32 g/mol. Its IUPAC name is 1-amino-1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea.
| Compound Name | 1-amino-1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea |
|---|---|
| PubChem CID | 70575388 |
| Molecular Formula | C20H20Cl2N6O4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1-amino-1-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea |
| SMILES | NC(=O)N(N)c1ccc(OCC2COC(Cn3cncn3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C20H20Cl2N6O4/c21-13-1-6-17(18(22)7-13)20(10-27-12-25-11-26-27)31-9-16(32-20)8-30-15-4-2-14(3-5-15)28(24)19(23)29/h1-7,11-12,16H,8-10,24H2,(H2,23,29) |
| InChIKey | ORJYGFRCLZVJSC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|