C22H19Cl2N5O4 — CID 54165753
2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 54165753) has the molecular formula C22H19Cl2N5O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is 2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 54165753 |
| Molecular Formula | C22H19Cl2N5O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2ccc(OC[C@@H]3CO[C@@](Cn4cncn4)(c4ccc(Cl)cc4Cl)O3)cc2)o1 |
| InChI | InChI=1S/C22H19Cl2N5O4/c1-14-27-28-21(32-14)15-2-5-17(6-3-15)30-9-18-10-31-22(33-18,11-29-13-25-12-26-29)19-7-4-16(23)8-20(19)24/h2-8,12-13,18H,9-11H2,1H3/t18-,22-/m1/s1 |
| InChIKey | ORNHVBJBBMYGTO-XMSQKQJNSA-N |
| XLogP | 4.29 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |