C23H22Cl2N6O6 — CID 70525356
1-[[2-(2,4-dichlorophenyl)-4-[[4-(3-methylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid (PubChem CID 70525356) has the molecular formula C23H22Cl2N6O6 and a molecular weight of 549.37 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-[[4-(3-methylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-[[4-(3-methylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70525356 |
| Molecular Formula | C23H22Cl2N6O6 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-[[4-(3-methylimidazol-4-yl)phenoxy]methyl]-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid |
| SMILES | Cn1cncc1-c1ccc(OCC2COC(Cn3cncn3)(c3ccc(Cl)cc3Cl)O2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C23H21Cl2N5O3.HNO3/c1-29-14-26-9-22(29)16-2-5-18(6-3-16)31-10-19-11-32-23(33-19,12-30-15-27-13-28-30)20-7-4-17(24)8-21(20)25;2-1(3)4/h2-9,13-15,19H,10-12H2,1H3;(H,2,3,4) |
| InChIKey | IDMYOCYILCNBBS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|