C24H24Cl2N6O9 — CID 88750870
5-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-methylimidazole;bis(nitric acid) (PubChem CID 88750870) has the molecular formula C24H24Cl2N6O9 and a molecular weight of 611.40 g/mol. Its IUPAC name is 5-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-methylimidazole;bis(nitric acid).
| Compound Name | 5-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-methylimidazole;bis(nitric acid) |
|---|---|
| PubChem CID | 88750870 |
| Molecular Formula | C24H24Cl2N6O9 |
| Molecular Weight | 611.40 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | 5-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-methylimidazole;bis(nitric acid) |
| SMILES | Cn1cncc1-c1ccc(OC[C@@H]2CO[C@@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C24H22Cl2N4O3.2HNO3/c1-29-15-28-11-23(29)17-2-5-19(6-3-17)31-12-20-13-32-24(33-20,14-30-9-8-27-16-30)21-7-4-18(25)10-22(21)26;2*2-1(3)4/h2-11,15-16,20H,12-14H2,1H3;2*(H,2,3,4)/t20-,24-;;/m1../s1 |
| InChIKey | PWFGEUFEOLZCKX-OYNPXDHBSA-N |
| XLogP | 4.24 |
| TPSA | 190.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|