C20H18Cl2N4O5 — CID 54010959
4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-nitroaniline (PubChem CID 54010959) has the molecular formula C20H18Cl2N4O5 and a molecular weight of 465.29 g/mol. Its IUPAC name is 4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-nitroaniline.
| Compound Name | 4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-nitroaniline |
|---|---|
| PubChem CID | 54010959 |
| Molecular Formula | C20H18Cl2N4O5 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-nitroaniline |
| SMILES | Nc1ccc(OC[C@@H]2CO[C@@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18Cl2N4O5/c21-13-1-3-16(17(22)7-13)20(11-25-6-5-24-12-25)30-10-15(31-20)9-29-14-2-4-18(23)19(8-14)26(27)28/h1-8,12,15H,9-11,23H2/t15-,20-/m1/s1 |
| InChIKey | KSHRODRQDCCOKX-FOIQADDNSA-N |
| XLogP | 4.03 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|