C25H27Cl2N5O4 — CID 12854726
4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxamide (PubChem CID 12854726) has the molecular formula C25H27Cl2N5O4 and a molecular weight of 532.43 g/mol. Its IUPAC name is 4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 12854726 |
| Molecular Formula | C25H27Cl2N5O4 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C25H27Cl2N5O4/c26-18-1-6-22(23(27)13-18)25(16-30-8-7-29-17-30)35-15-21(36-25)14-34-20-4-2-19(3-5-20)31-9-11-32(12-10-31)24(28)33/h1-8,13,17,21H,9-12,14-16H2,(H2,28,33) |
| InChIKey | LWAARGOTOFUSTF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|